Difference between revisions of "CPD-698"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-KETO-2-METHYLVALERATE 1-KETO-2-METHYLVALERATE] == * smiles: ** CCC(O)(C)C(C([O-])=O)O * commo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
− | ** | + | ** campest-4-en-3-one |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 398.671 |
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** methylcholestenone |
+ | ** (24R)-24-methyl-cholest-4-en-3-one | ||
+ | ** 3-dehydro-Δ4-5-campesterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-711]] |
− | * [[ | + | * [[RXN-4231]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11988279 11988279] |
− | * HMDB : | + | * HMDB : HMDB12196 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785] |
− | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | |
− | + | {{#set: common name=campest-4-en-3-one}} | |
− | + | {{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}} | |
− | + | {{#set: molecular weight=398.671 }} | |
− | + | {{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}} | |
− | {{#set: smiles= | + | {{#set: consumed by=RXN-711|RXN-4231}} |
− | {{#set: common name= | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name=( | + | |
− | {{#set: consumed by= | + | |
− | + |
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite CPD-698
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- campest-4-en-3-one
- inchi key:
- InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
- molecular weight:
- 398.671
- Synonym(s):
- methylcholestenone
- (24R)-24-methyl-cholest-4-en-3-one
- 3-dehydro-Δ4-5-campesterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.