|
|
| Line 1: |
Line 1: |
| − | [[Category:Metabolite]] | + | [[Category:Gene]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12311 CPD-12311] == | + | == Gene Tiso_gene_9268 == |
| − | * smiles:
| + | |
| − | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C3(OC9(OC(CO)C(OC8(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC(N)C(NC(=O)C(C)NC(=O)C(CCCCNC(CC([N+])C(N)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC7(C(OC6(OC(CO)C(OC5(OC(CO)C(OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC(N)C(NC(=O)C(C)NC(=O)C(CCCCNC(CC([N+])C(N)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC3C(NC(C)=O)4)C(=O)N)=O)=O)C(NC(C)C(=O)[O-])=O)C(=O)N)C(NC(C)=O)5))C(O)C(NC(=O)C)6))C(CO)OC(O)C(NC(C)=O)7))C(=O)N)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)8))C(O)C(NC(=O)C)9))))C)C)C)C)C)C
| + | |
| − | * common name:
| + | |
| − | ** a peptidoglycan with D,D cross-link (E. faecium)
| + | |
| − | * inchi key:
| + | |
| − | ** InChIKey=SEILTNKQZGHVNR-OTCLWVBASA-L
| + | |
| − | * molecular weight:
| + | |
| − | ** 4871.312
| + | |
| | * Synonym(s): | | * Synonym(s): |
| − | ** N-acetylglucosamine--N-acetylmuramoyl-(tetrapeptide) diphospho-undecaprenol dimer with D,D cross-link (S. aureus)
| |
| | | | |
| − | == Reaction(s) known to consume the compound == | + | == Reactions associated == |
| − | == Reaction(s) known to produce the compound ==
| + | * Reaction: [[6.3.2.25-RXN]] |
| − | * [[RXN-11351]] | + | ** Source: [[orthology-esiliculosus]] |
| − | == Reaction(s) of unknown directionality == | + | == Pathways associated == |
| | == External links == | | == External links == |
| − | * PUBCHEM:
| + | {{#set: reaction associated=6.3.2.25-RXN}} |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658540 90658540]
| + | |
| − | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C3(OC9(OC(CO)C(OC8(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC(N)C(NC(=O)C(C)NC(=O)C(CCCCNC(CC([N+])C(N)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC7(C(OC6(OC(CO)C(OC5(OC(CO)C(OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CC(N)C(NC(=O)C(C)NC(=O)C(CCCCNC(CC([N+])C(N)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC3C(NC(C)=O)4)C(=O)N)=O)=O)C(NC(C)C(=O)[O-])=O)C(=O)N)C(NC(C)=O)5))C(O)C(NC(=O)C)6))C(CO)OC(O)C(NC(C)=O)7))C(=O)N)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)8))C(O)C(NC(=O)C)9))))C)C)C)C)C)C}} | + | |
| − | {{#set: common name=a peptidoglycan with D,D cross-link (E. faecium)}}
| + | |
| − | {{#set: inchi key=InChIKey=SEILTNKQZGHVNR-OTCLWVBASA-L}}
| + | |
| − | {{#set: molecular weight=4871.312 }}
| + | |
| − | {{#set: common name=N-acetylglucosamine--N-acetylmuramoyl-(tetrapeptide) diphospho-undecaprenol dimer with D,D cross-link (S. aureus)}}
| + | |
| − | {{#set: produced by=RXN-11351}}
| + | |
