Difference between revisions of "CPD-13008"

Latest revision as of 20:16, 21 March 2018

"C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_3173 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] ==
+* smiles:
+** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O
+* common name:
+** 3',5'-diiodothyronine
+* inchi key:
+** InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N
+* molecular weight:
+** 525.081
 * Synonym(s):
+** 3',5'-diiodo-L-thyronine
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* Reaction: [[THIAZOLSYN3-RXN]]
+* [[RXN-12037]]
-** Source: [[orthology-esiliculosus]]
+== Reaction(s) known to produce the compound ==
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
-* [[PWY-6897]]
-* [[PWY-7356]]
-* [[PWY-7357]]
 == External links  ==
-{{#set: reaction associated=THIAZOLSYN3-RXN}}
+* PUBCHEM:
-{{#set: pathway associated=PWY-6897|PWY-7356|PWY-7357}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986088 50986088]
+{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O}}
+{{#set: common name=3',5'-diiodothyronine}}
+{{#set: inchi key=InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N}}
+{{#set: molecular weight=525.081    }}
+{{#set: common name=3',5'-diiodo-L-thyronine}}
+{{#set: consumed by=RXN-12037}}