Difference between revisions of "CPD-7090"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_7039 == * right end position: ** 2896 * transcription direction: ** POSITIVE * left end position: ** 618 * centisome position: ** 3.5737004...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-]...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_7039 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] ==
* right end position:
+
* smiles:
** 2896
+
** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
* transcription direction:
+
* common name:
** POSITIVE
+
** delphinidin
* left end position:
+
* inchi key:
** 618
+
** InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
* centisome position:
+
* molecular weight:
** 3.5737004    
+
** 301.232    
 
* Synonym(s):
 
* Synonym(s):
 +
** delfinidin
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[1.5.1.9-RXN]]
+
* [[RXN-9723]]
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: automated-name-match
+
* [[RXN-7785]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[LYSINE-DEG1-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: right end position=2896}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203213 25203213]
{{#set: left end position=618}}
+
* HMDB : HMDB03074
{{#set: centisome position=3.5737004   }}
+
* CHEBI:
{{#set: reaction associated=1.5.1.9-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28436 28436]
{{#set: pathway associated=LYSINE-DEG1-PWY}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05908 C05908]
 +
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))}}
 +
{{#set: common name=delphinidin}}
 +
{{#set: inchi key=InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=301.232   }}
 +
{{#set: common name=delfinidin}}
 +
{{#set: consumed by=RXN-9723}}
 +
{{#set: produced by=RXN-7785}}

Latest revision as of 20:16, 21 March 2018

Metabolite CPD-7090

  • smiles:
    • C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
  • common name:
    • delphinidin
  • inchi key:
    • InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
  • molecular weight:
    • 301.232
  • Synonym(s):
    • delfinidin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))" cannot be used as a page name in this wiki.