Difference between revisions of "CPD-653"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14791 == * right end position: ** 2967 * transcription direction: ** POSITIVE * left end position: ** 114 * centisome position: ** 2.102157...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-653 CPD-653] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-653 CPD-653] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O) |
| − | * | + | * common name: |
| − | ** | + | ** (S)-NADHX |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=IDBZKGQRLBFUFQ-VPHRTNKSSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 681.445 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (6S)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-12753]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203523 25203523] |
| − | {{#set: | + | * HMDB : HMDB59644 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64074 64074] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04856 C04856] | ||
| + | {{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}} | ||
| + | {{#set: common name=(S)-NADHX}} | ||
| + | {{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-VPHRTNKSSA-L}} | ||
| + | {{#set: molecular weight=681.445 }} | ||
| + | {{#set: common name=(6S)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}} | ||
| + | {{#set: produced by=RXN-12753}} | ||
Latest revision as of 21:17, 21 March 2018
Contents
Metabolite CPD-653
- smiles:
- C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
- common name:
- (S)-NADHX
- inchi key:
- InChIKey=IDBZKGQRLBFUFQ-VPHRTNKSSA-L
- molecular weight:
- 681.445
- Synonym(s):
- (6S)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)" cannot be used as a page name in this wiki.
