Difference between revisions of "CPD-17621"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-302 CPD-302] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * common name: ** D-aspartate * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17621 CPD-17621] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17621 CPD-17621] == |
* smiles: | * smiles: | ||
− | ** C(C(=O)[O-]) | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
− | ** | + | ** 16-hydroxypalmitoyl-CoA |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=ROZGNNDROQHXPF-BBECNAHFSA-J |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1017.914 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ω-hydroxy-hexadecanoyl-coenzyme A |
+ | ** ω-hydroxypalmitoyl-CoA | ||
+ | ** 16-hydroxy-hexadecanoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-16389]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86583440 86583440] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84207 84207] |
− | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | {{#set: smiles=C(C(=O)[O-]) | + | {{#set: common name=16-hydroxypalmitoyl-CoA}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=ROZGNNDROQHXPF-BBECNAHFSA-J}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=1017.914 }} |
− | {{#set: molecular weight= | + | {{#set: common name=ω-hydroxy-hexadecanoyl-coenzyme A|ω-hydroxypalmitoyl-CoA|16-hydroxy-hexadecanoyl-CoA}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-16389}} |
− | {{#set: | + |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite CPD-17621
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 16-hydroxypalmitoyl-CoA
- inchi key:
- InChIKey=ROZGNNDROQHXPF-BBECNAHFSA-J
- molecular weight:
- 1017.914
- Synonym(s):
- ω-hydroxy-hexadecanoyl-coenzyme A
- ω-hydroxypalmitoyl-CoA
- 16-hydroxy-hexadecanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.