Difference between revisions of "Tiso gene 12959"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-6-SOLANYL-14-BENZOQUINONE 2-METHYL-6-SOLANYL-14-BENZOQUINONE] == * smiles: ** CC(=CCCC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12959 == * right end position: ** 4643 * transcription direction: ** POSITIVE * left end position: ** 289 * centisome position: ** 4.377461...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-6-SOLANYL-14-BENZOQUINONE 2-METHYL-6-SOLANYL-14-BENZOQUINONE] ==
+
== Gene Tiso_gene_12959 ==
−
* smiles:
+
* right end position:
−
** CC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCC1(=C(O)C(C)=CC(O)=C1))C)C)C)C
+
** 4643
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SWKACZQJGXABCN-JSGWLJPKSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
+
** 289
−
* molecular weight:
+
* centisome position:
−
** 737.203    
+
** 4.3774614    
 
* Synonym(s):
 
* Synonym(s):
−
** MSBQ
 
−
** 2-methyl-6-solanesyl-1,4-benzoquinol
 
−
** 2-methyl-6--all-trans-nonaprenyl-benzene-1,4-diol
 
−
** 2-methyl-6-solanyl-1,4-benzoquinol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-2762]]
+
* Reaction: [[PHOSPHOLIPASE-A2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[R600]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-15065]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15067]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15068]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16138]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16139]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17735]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17736]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6725]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY66-397]]
 +
* [[PWY-6803]]
 +
* [[PWY-7409]]
 +
* [[PWY66-394]]
 +
* [[PWY66-395]]
 +
* [[PWY-7783]]
 +
* [[PWY-7417]]
 +
* [[PWY-7416]]
 +
* [[LIPASYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4643}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237185 44237185]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=289}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75402 75402]
+
{{#set: centisome position=4.3774614   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PHOSPHOLIPASE-A2-RXN|RXN-15065|RXN-15067|RXN-15068|RXN-16138|RXN-16139|RXN-17735|RXN-17736|RXN0-6725}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C17570 C17570]
+
{{#set: pathway associated=PWY66-397|PWY-6803|PWY-7409|PWY66-394|PWY66-395|PWY-7783|PWY-7417|PWY-7416|LIPASYN-PWY}}
−
{{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCC1(=C(O)C(C)=CC(O)=C1))C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=SWKACZQJGXABCN-JSGWLJPKSA-N}}
+
−
{{#set: common name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
+
−
{{#set: molecular weight=737.203   }}
+
−
{{#set: common name=MSBQ|2-methyl-6-solanesyl-1,4-benzoquinol|2-methyl-6--all-trans-nonaprenyl-benzene-1,4-diol|2-methyl-6-solanyl-1,4-benzoquinol}}
+
−
{{#set: consumed by=RXN-2762}}
+
−
{{#set: produced by=R600}}
+

Latest revision as of 19:40, 21 March 2018

Gene Tiso_gene_12959

  • right end position:
    • 4643
  • transcription direction:
    • POSITIVE
  • left end position:
    • 289
  • centisome position:
    • 4.3774614
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12959&oldid=43077"