Difference between revisions of "Tiso gene 13558"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...") |
(Created page with "Category:Gene == Gene Tiso_gene_13558 == * right end position: ** 3312 * transcription direction: ** POSITIVE * left end position: ** 174 * centisome position: ** 2.796079...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_13558 == |
| − | * | + | * right end position: |
| − | ** | + | ** 3312 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| + | * left end position: | ||
| + | ** 174 | ||
| + | * centisome position: | ||
| + | ** 2.796079 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[FORMAMIDASE-RXN]] | |
| − | == | + | ** Source: [[annotation-in-silico_annotation]] |
| − | * [[ | + | *** Assignment: automated-name-match |
| + | == Pathways associated == | ||
| + | * [[PWY-7142]] | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=3312}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=174}} |
| − | {{#set: | + | {{#set: centisome position=2.796079 }} |
| − | {{#set: | + | {{#set: reaction associated=FORMAMIDASE-RXN}} |
| + | {{#set: pathway associated=PWY-7142}} | ||
Latest revision as of 20:19, 21 March 2018
Gene Tiso_gene_13558
- right end position:
- 3312
- transcription direction:
- POSITIVE
- left end position:
- 174
- centisome position:
- 2.796079
- Synonym(s):
Reactions associated
- Reaction: FORMAMIDASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
