Difference between revisions of "CPD-7137"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15130 RXN-15130] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15130 RXN-15130] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/4.4.1.1 EC-4.4.1.1]
+
** pelargonidin-3,5-di-O-β-D-glucoside
 +
* inchi key:
 +
** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
 +
* molecular weight:
 +
** 594.525   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[L-CYSTATHIONINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[2-OXOBUTANOATE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[CYS]][c]
+
* [[RXN-7828]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-cystathionine[c] '''+''' 1 H2O[c] '''=>''' 1 2-oxobutanoate[c] '''+''' 1 ammonium[c] '''+''' 1 L-cysteine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_3732]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01001 R01001]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643]
−
* UNIPROT:
+
* HMDB : HMDB33681
−
** [http://www.uniprot.org/uniprot/P21357 P21357]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P18757 P18757]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503]
−
** [http://www.uniprot.org/uniprot/P32929 P32929]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P31373 P31373]
+
** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725]
−
** [http://www.uniprot.org/uniprot/Q47847 Q47847]
+
{{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=pelargonidin-3,5-di-O-β-D-glucoside}}
−
{{#set: ec number=EC-4.4.1.1}}
+
{{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}}
−
{{#set: gene associated=Tiso_gene_3732}}
+
{{#set: molecular weight=594.525    }}
−
{{#set: in pathway=}}
+
{{#set: produced by=RXN-7828}}
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-7137

  • smiles:
    • C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
  • common name:
    • pelargonidin-3,5-di-O-β-D-glucoside
  • inchi key:
    • InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
  • molecular weight:
    • 594.525
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7137&oldid=47782"