Difference between revisions of "CPD-6994"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.10.1-RXN 2.7.10.1-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * co...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.10.1-RXN 2.7.10.1-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
 
* common name:
 
* common name:
−
** ORF
+
** (2S)-eriodictyol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.10.2 EC-2.7.10.2]
+
** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
−
** [http://enzyme.expasy.org/EC/2.7.12.1 EC-2.7.12.1]
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.10.1 EC-2.7.10.1]
+
** 287.248   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7775]]
−
** 1 [[Protein-Tyrosines]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Protein-tyrosine-phosphates]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a [protein]-L-tyrosine[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 a [protein]-L-tyrosine phosphate[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_5584]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_1492]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_1810]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_2393]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_10356]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_9800]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_6071]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_17980]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_18523]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_17047]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_10355]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_14940]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_14941]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_15652]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_12229]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02584 R02584]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB05810
−
{{#set: common name=ORF}}
+
* CHEBI:
−
{{#set: ec number=EC-2.7.10.2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412]
−
{{#set: ec number=EC-2.7.12.1}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.7.10.1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631]
−
{{#set: gene associated=Tiso_gene_5584|Tiso_gene_1492|Tiso_gene_1810|Tiso_gene_2393|Tiso_gene_10356|Tiso_gene_9800|Tiso_gene_6071|Tiso_gene_17980|Tiso_gene_18523|Tiso_gene_17047|Tiso_gene_10355|Tiso_gene_14940|Tiso_gene_14941|Tiso_gene_15652|Tiso_gene_12229}}
+
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}}
−
{{#set: in pathway=}}
+
{{#set: common name=(2S)-eriodictyol}}
−
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}}
−
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
+
{{#set: molecular weight=287.248    }}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: consumed by=RXN-7775}}

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-6994

  • smiles:
    • C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
  • common name:
    • (2S)-eriodictyol
  • inchi key:
    • InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
  • molecular weight:
    • 287.248
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-6994&oldid=47793"