Difference between revisions of "CPD-10284"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10284 CPD-10284] == * smiles: ** CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10284 CPD-10284] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxo-myristoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=IQNFBGHLIVBNOU-QSGBVPJFSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 987.845 |
* Synonym(s): | * Synonym(s): | ||
− | ** 3- | + | ** 3-oxotetradecanoyl-CoA |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14268]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12507]] |
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[ACACT6]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05261 C05261] |
+ | * HMDB : HMDB03935 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62543 62543] |
− | * BIGG : | + | * BIGG : 3otdcoa |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245316 25245316] |
− | {{#set: | + | {{#set: smiles=CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: molecular weight= | + | {{#set: common name=3-oxo-myristoyl-CoA}} |
− | {{#set: common name=3- | + | {{#set: inchi key=InChIKey=IQNFBGHLIVBNOU-QSGBVPJFSA-J}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=987.845 }} |
− | {{#set: produced by= | + | {{#set: common name=3-oxotetradecanoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-14268}} |
+ | {{#set: produced by=RXN-12507}} | ||
+ | {{#set: reversible reaction associated=ACACT6}} |
Latest revision as of 20:40, 21 March 2018
Contents
Metabolite CPD-10284
- smiles:
- CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxo-myristoyl-CoA
- inchi key:
- InChIKey=IQNFBGHLIVBNOU-QSGBVPJFSA-J
- molecular weight:
- 987.845
- Synonym(s):
- 3-oxotetradecanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.