Difference between revisions of "PWY-5965"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * smiles: ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) * inchi key: ** InChIKey=K...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5965 PWY-5965] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5965 PWY-5965] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** fatty acid biosynthesis initiation III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]] | |
− | == Reaction(s) | + | ** 9 associated gene(s): |
+ | *** [[Tiso_gene_5939]] | ||
+ | *** [[Tiso_gene_500]] | ||
+ | *** [[Tiso_gene_14485]] | ||
+ | *** [[Tiso_gene_13394]] | ||
+ | *** [[Tiso_gene_136]] | ||
+ | *** [[Tiso_gene_15991]] | ||
+ | *** [[Tiso_gene_135]] | ||
+ | *** [[Tiso_gene_19302]] | ||
+ | *** [[Tiso_gene_10876]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACPDECARBOX-RXN MALONYL-ACPDECARBOX-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5965 PWY-5965] |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=fatty acid biosynthesis initiation III}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:40, 21 March 2018
Pathway PWY-5965
- taxonomic range:
- common name:
- fatty acid biosynthesis initiation III
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- 3-OXOACYL-ACP-SYNTH-BASE-RXN
- 9 associated gene(s):
- 6 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: