Difference between revisions of "Tiso gene 5047"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
(Created page with "Category:Gene == Gene Tiso_gene_5047 == * right end position: ** 13971 * transcription direction: ** POSITIVE * left end position: ** 11687 * centisome position: ** 83.639...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
+
== Gene Tiso_gene_5047 ==
* smiles:
+
* right end position:
** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
+
** 13971
* common name:
+
* transcription direction:
** XLLG xyloglucan oligosaccharide
+
** POSITIVE
* inchi key:
+
* left end position:
** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
+
** 11687
* molecular weight:
+
* centisome position:
** 1387.215    
+
** 83.63988    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12400]]
+
* Reaction: [[HISTCYCLOHYD-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[HISTSYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=13971}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}}
+
{{#set: left end position=11687}}
{{#set: common name=XLLG xyloglucan oligosaccharide}}
+
{{#set: centisome position=83.63988    }}
{{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}}
+
{{#set: reaction associated=HISTCYCLOHYD-RXN}}
{{#set: molecular weight=1387.215    }}
+
{{#set: pathway associated=HISTSYN-PWY}}
{{#set: consumed by=RXN-12400}}
+

Latest revision as of 20:20, 21 March 2018

Gene Tiso_gene_5047

  • right end position:
    • 13971
  • transcription direction:
    • POSITIVE
  • left end position:
    • 11687
  • centisome position:
    • 83.63988
  • Synonym(s):

Reactions associated

Pathways associated

External links