Difference between revisions of "ACOA160or"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] == * smiles: ** C([N+])C2(C1(C(=O)NC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA160or ACOA160or] == * direction: ** LEFT-TO-RIGHT * common name: ** Palmitoyl-CoA:oxygen 2-oxid...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA160or ACOA160or] ==
−
* smiles:
+
* direction:
−
** C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** preQ1
+
** Palmitoyl-CoA:oxygen 2-oxidoreductase
−
* inchi key:
+
−
** InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O
+
−
* molecular weight:
+
−
** 180.189   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7-aminomethyl-7-deazaguanine
 
−
** 7-aminomethyl-7-carbaguanine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-1321]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PALMITYL-COA]][x] '''+''' 1.0 [[FAD]][x] '''=>''' 1.0 [[CPD0-2117]][x] '''+''' 1.0 [[FADH2]][x]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 palmitoyl-CoA[x] '''+''' 1.0 FAD[x] '''=>''' 1.0 trans-hexadec-2-enoyl-CoA[x] '''+''' 1.0 FADH2[x]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_8272]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_16674]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202264 25202264]
+
{{#set: common name=Palmitoyl-CoA:oxygen 2-oxidoreductase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_18566|Tiso_gene_17967|Tiso_gene_8272|Tiso_gene_16674}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58703 58703]
+
{{#set: in pathway=}}
−
{{#set: smiles=C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=preQ1}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: inchi key=InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=180.189    }}
+
−
{{#set: common name=7-aminomethyl-7-deazaguanine|7-aminomethyl-7-carbaguanine}}
+
−
{{#set: consumed by=RXN0-1321}}
+

Latest revision as of 20:20, 21 March 2018

Reaction ACOA160or

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Palmitoyl-CoA:oxygen 2-oxidoreductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 palmitoyl-CoA[x] + 1.0 FAD[x] => 1.0 trans-hexadec-2-enoyl-CoA[x] + 1.0 FADH2[x]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ACOA160or&oldid=47957"