Difference between revisions of "CPD-707"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-452 CPD-452] == * common name: ** a 6-(N-acetyl-α-D-glucosaminyl)-1-phosphatidyl-1D-m...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] == |
| + | * smiles: | ||
| + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
* common name: | * common name: | ||
| − | ** | + | ** campesterol |
| + | * inchi key: | ||
| + | ** InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N | ||
| + | * molecular weight: | ||
| + | ** 400.687 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cholest 5-en-3-ol, 24-methyl |
| + | ** ergost-5-en-3β-ol, (24R)- | ||
| + | ** (24R)-24-methylcholest-5-en-3β-ol | ||
| + | ** 24(R)-methylcholesterol | ||
| + | ** campesterin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-4225]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMST01030097 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=173183 173183] |
| + | * HMDB : HMDB02869 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01789 C01789] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10469749.html 10469749] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28623 28623] | ||
| + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=campesterol}} | ||
| + | {{#set: inchi key=InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N}} | ||
| + | {{#set: molecular weight=400.687 }} | ||
| + | {{#set: common name=cholest 5-en-3-ol, 24-methyl|ergost-5-en-3β-ol, (24R)-|(24R)-24-methylcholest-5-en-3β-ol|24(R)-methylcholesterol|campesterin}} | ||
| + | {{#set: consumed by=RXN-4225}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-707
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- campesterol
- inchi key:
- InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N
- molecular weight:
- 400.687
- Synonym(s):
- cholest 5-en-3-ol, 24-methyl
- ergost-5-en-3β-ol, (24R)-
- (24R)-24-methylcholest-5-en-3β-ol
- 24(R)-methylcholesterol
- campesterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMST01030097
- PUBCHEM:
- HMDB : HMDB02869
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
