Difference between revisions of "Tiso gene 2323"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * common name: ** di-homo-&g...") |
(Created page with "Category:Gene == Gene Tiso_gene_2323 == * right end position: ** 17625 * transcription direction: ** NEGATIVE * left end position: ** 15290 * centisome position: ** 54.488...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2323 == |
− | * | + | * right end position: |
− | ** | + | ** 17625 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 15290 |
− | * | + | * centisome position: |
− | ** | + | ** 54.488438 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[MALATE-DEH-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-561]] | ||
+ | * [[PWY-5913]] | ||
+ | * [[PWY-1622]] | ||
+ | * [[PWY66-399]] | ||
+ | * [[P42-PWY]] | ||
+ | * [[PWY-7383]] | ||
+ | * [[PWY-5392]] | ||
+ | * [[TCA]] | ||
+ | * [[P105-PWY]] | ||
+ | * [[P23-PWY]] | ||
+ | * [[PWY-5690]] | ||
+ | * [[GLYOXYLATE-BYPASS]] | ||
+ | * [[FERMENTATION-PWY]] | ||
+ | * [[PWY-6728]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[P108-PWY]] | ||
+ | * [[MALATE-ASPARTATE-SHUTTLE-PWY]] | ||
+ | * [[PWY66-398]] | ||
+ | * [[PWY-6969]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=17625}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=15290}} | |
− | + | {{#set: centisome position=54.488438 }} | |
− | + | {{#set: reaction associated=MALATE-DEH-RXN}} | |
− | + | {{#set: pathway associated=PWY-561|PWY-5913|PWY-1622|PWY66-399|P42-PWY|PWY-7383|PWY-5392|TCA|P105-PWY|P23-PWY|PWY-5690|GLYOXYLATE-BYPASS|FERMENTATION-PWY|PWY-6728|PWY-7115|GLUCONEO-PWY|P108-PWY|MALATE-ASPARTATE-SHUTTLE-PWY|PWY66-398|PWY-6969}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:22, 21 March 2018
Gene Tiso_gene_2323
- right end position:
- 17625
- transcription direction:
- NEGATIVE
- left end position:
- 15290
- centisome position:
- 54.488438
- Synonym(s):
Reactions associated
- Reaction: MALATE-DEH-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-athaliana
- Source: orthology-athaliana
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
Pathways associated
- PWY-561
- PWY-5913
- PWY-1622
- PWY66-399
- P42-PWY
- PWY-7383
- PWY-5392
- TCA
- P105-PWY
- P23-PWY
- PWY-5690
- GLYOXYLATE-BYPASS
- FERMENTATION-PWY
- PWY-6728
- PWY-7115
- GLUCONEO-PWY
- P108-PWY
- MALATE-ASPARTATE-SHUTTLE-PWY
- PWY66-398
- PWY-6969