Difference between revisions of "RXN1G-384"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16261 RXN-16261] == * direction: ** REVERSIBLE * common name: ** phospholipase_c_beta_4 ** 1-ph...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-384 RXN1G-384] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta7,25-3-oxo-C44...") |
||
Line 1: | Line 1: | ||
[[Category:Reaction]] | [[Category:Reaction]] | ||
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object= | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-384 RXN1G-384] == |
* direction: | * direction: | ||
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** cis,cis-delta7,25-3-oxo-C44:2-[acyl-carrier protein] reductase |
− | + | ||
* ec number: | * ec number: | ||
− | ** [http://enzyme.expasy.org/EC/ | + | ** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9] |
* Synonym(s): | * Synonym(s): | ||
== Reaction Formula == | == Reaction Formula == | ||
* With identifiers: | * With identifiers: | ||
− | ** 1 [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[cis-cis-D7-25-3-oxo-C44-2-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[cis-cis-D7-25-3-hydroxyC44-2-ACPs]][c] |
* With common name(s): | * With common name(s): | ||
− | ** 1 | + | ** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a cis,cis-delta7,25-3-oxo-C44:2-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a cis,cis-delta7,25-3-hydroxyC44:2-[acp][c] |
== Genes associated with this reaction == | == Genes associated with this reaction == | ||
Genes have been associated with this reaction based on different elements listed below. | Genes have been associated with this reaction based on different elements listed below. | ||
− | * Gene: [[ | + | * Gene: [[Tiso_gene_13083]] |
− | ** Source: [[ | + | ** Source: [[orthology-esiliculosus]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Pathways == | == Pathways == | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
== Reconstruction information == | == Reconstruction information == | ||
− | * Category: [[ | + | * Category: [[orthology]] |
− | ** Source: [[ | + | ** Source: [[orthology-esiliculosus]] |
− | *** Tool: [[ | + | *** Tool: [[pantograph]] |
== External links == | == External links == | ||
− | {{#set: direction= | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: common name= | + | {{#set: common name=cis,cis-delta7,25-3-oxo-C44:2-[acyl-carrier protein] reductase}} |
− | + | {{#set: ec number=EC-1.1.1.M9}} | |
− | {{#set: ec number=EC- | + | {{#set: gene associated=Tiso_gene_13083}} |
− | {{#set: gene associated= | + | {{#set: in pathway=PWYG-321}} |
− | {{#set: in pathway=}} | + | {{#set: reconstruction category=orthology}} |
− | {{#set: reconstruction category= | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: reconstruction source= | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: reconstruction tool= | + |
Latest revision as of 20:22, 21 March 2018
Contents
Reaction RXN1G-384
- direction:
- LEFT-TO-RIGHT
- common name:
- cis,cis-delta7,25-3-oxo-C44:2-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 NADPH[c] + 1 cis-cis-D7-25-3-oxo-C44-2-ACPs[c] => 1 NADP[c] + 1 cis-cis-D7-25-3-hydroxyC44-2-ACPs[c]
- With common name(s):
- 1 H+[c] + 1 NADPH[c] + 1 a cis,cis-delta7,25-3-oxo-C44:2-[acp][c] => 1 NADP+[c] + 1 a cis,cis-delta7,25-3-hydroxyC44:2-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13083
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
"cis,cis-delta7,25-3-oxo-C44:2-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.