Difference between revisions of "5-METHYL-THF-GLU-N"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF-GLU-N 5-METHYL-THF-GLU-N] == * common name: ** an N5-methyl-tetrahydrofolate * Syn...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF-GLU-N 5-METHYL-THF-GLU-N] ==
* smiles:
+
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
+
 
* common name:
 
* common name:
** 5-hydroxyferulate
+
** an N5-methyl-tetrahydrofolate
* inchi key:
+
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
+
* molecular weight:
+
** 209.178   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-hydroxy ferulic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-3422]]
+
* [[HOMOCYSMETB12-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1121]]
+
* [[1.5.1.20-RXN]]
 +
* [[RXN-5061]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N5-methyl-tetrahydrofolate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
+
{{#set: consumed by=HOMOCYSMETB12-RXN}}
* HMDB : HMDB35484
+
{{#set: produced by=1.5.1.20-RXN|RXN-5061}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
+
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
+
{{#set: common name=5-hydroxyferulate}}
+
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
+
{{#set: molecular weight=209.178    }}
+
{{#set: common name=5-hydroxy ferulic acid}}
+
{{#set: consumed by=RXN-3422}}
+
{{#set: produced by=RXN-1121}}
+

Latest revision as of 20:22, 21 March 2018

Metabolite 5-METHYL-THF-GLU-N

  • common name:
    • an N5-methyl-tetrahydrofolate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links