Difference between revisions of "Tiso gene 14341"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * smiles: ** C12(NC(=O)NC(C=1N=CN2)=O) * common name: ** xanthine * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_14341 == * Synonym(s): == Reactions associated == * Reaction: CERAMIDASE-RXN ** Source: orthology-esiliculosus * Reaction: CERAM...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14341 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CERAMIDASE-RXN]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | + | * Reaction: [[CERAMIDASE-YEAST-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[RXN-11375]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[RXN-13733]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[RXN-646]] |
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY3DJ-11470]] | ||
+ | * [[PWY-722]] | ||
+ | * [[PWY-5033]] | ||
+ | * [[PWY-6993]] | ||
+ | * [[PWY-7128]] | ||
+ | * [[PWY-6483]] | ||
+ | * [[PWY-7119]] | ||
+ | * [[PWY66-388]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=CERAMIDASE-RXN|CERAMIDASE-YEAST-RXN|RXN-11375|RXN-13733|RXN-646}} | |
− | + | {{#set: pathway associated=PWY3DJ-11470|PWY-722|PWY-5033|PWY-6993|PWY-7128|PWY-6483|PWY-7119|PWY66-388}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 21:23, 21 March 2018
Gene Tiso_gene_14341
- Synonym(s):
Reactions associated
- Reaction: CERAMIDASE-RXN
- Source: orthology-esiliculosus
- Reaction: CERAMIDASE-YEAST-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-11375
- Source: orthology-esiliculosus
- Reaction: RXN-13733
- Source: orthology-esiliculosus
- Reaction: RXN-646
- Source: orthology-athaliana
- Source: orthology-esiliculosus