Difference between revisions of "RXN0-2301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * common name: ** nitroben...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2301 RXN0-2301] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2301 RXN0-2301] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.8.4 EC-1.3.8.4] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[PROTON]][c] '''+''' 1 [[ETF-Oxidized]][c] '''+''' 1 [[ISOVALERYL-COA]][c] '''=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[3-METHYL-CROTONYL-COA]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H+[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 isovaleryl-CoA[c] '''=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 3-methylcrotonyl-CoA[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_18542]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[LEU-DEG2-PWY]], L-leucine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=LEU-DEG2-PWY LEU-DEG2-PWY] | ||
| + | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12276 12276] | |
| − | ** [http:// | + | * LIGAND-RXN: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04096 R04096] | |
| − | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.3.8.4}} |
| − | + | {{#set: gene associated=Tiso_gene_18542}} | |
| − | + | {{#set: in pathway=LEU-DEG2-PWY}} | |
| − | + | {{#set: reconstruction category=orthology|annotation}} | |
| − | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:23, 21 March 2018
Contents
Reaction RXN0-2301
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 ETF-Oxidized[c] + 1 ISOVALERYL-COA[c] => 1 ETF-Reduced[c] + 1 3-METHYL-CROTONYL-COA[c]
- With common name(s):
- 1 H+[c] + 1 an oxidized electron-transfer flavoprotein[c] + 1 isovaleryl-CoA[c] => 1 a reduced electron-transfer flavoprotein[c] + 1 3-methylcrotonyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18542
- Source: orthology-esiliculosus
Pathways
- LEU-DEG2-PWY, L-leucine degradation I: LEU-DEG2-PWY
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
