Difference between revisions of "R-3-hydroxymyristoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * common name: ** tributy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxymyristoyl-ACPs R-3-hydroxymyristoyl-ACPs] == * common name: ** a (3R)-3-hydroxymyris...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxymyristoyl-ACPs R-3-hydroxymyristoyl-ACPs] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a (3R)-3-hydroxymyristoyl-[acp] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a β-hydroxymyristoyl-[acp] |
− | ** | + | ** a (3R)-3-hydroxymyristoyl-[acyl-carrier protein] |
− | ** | + | ** an (R)-3-hydroxytetradecanoyl-[acyl-carrier protein] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9537]] |
+ | * [[UDPNACETYLGLUCOSAMACYLTRANS-RXN]] | ||
+ | * [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9536]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a (3R)-3-hydroxymyristoyl-[acp]}} | |
− | + | {{#set: common name=a β-hydroxymyristoyl-[acp]|a (3R)-3-hydroxymyristoyl-[acyl-carrier protein]|an (R)-3-hydroxytetradecanoyl-[acyl-carrier protein]}} | |
− | + | {{#set: consumed by=RXN-9537|UDPNACETYLGLUCOSAMACYLTRANS-RXN|UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN}} | |
− | + | {{#set: produced by=RXN-9536}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite R-3-hydroxymyristoyl-ACPs
- common name:
- a (3R)-3-hydroxymyristoyl-[acp]
- Synonym(s):
- a β-hydroxymyristoyl-[acp]
- a (3R)-3-hydroxymyristoyl-[acyl-carrier protein]
- an (R)-3-hydroxytetradecanoyl-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (3R)-3-hydroxymyristoyl-[acp" cannot be used as a page name in this wiki.
- "a β-hydroxymyristoyl-[acp" cannot be used as a page name in this wiki.
- "a (3R)-3-hydroxymyristoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
- "an (R)-3-hydroxytetradecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.