|
|
Line 1: |
Line 1: |
− | [[Category:Gene]] | + | [[Category:Metabolite]] |
− | == Gene Tiso_gene_12899 == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONATE-S-ALD MALONATE-S-ALD] == |
− | * right end position: | + | * smiles: |
− | ** 6537 | + | ** [CH](=O)CC([O-])=O |
− | * transcription direction: | + | * common name: |
− | ** NEGATIVE | + | ** 3-oxopropanoate |
− | * left end position: | + | * inchi key: |
− | ** 3684 | + | ** InChIKey=OAKURXIZZOAYBC-UHFFFAOYSA-M |
− | * centisome position: | + | * molecular weight: |
− | ** 55.398495 | + | ** 87.055 |
| * Synonym(s): | | * Synonym(s): |
| + | ** malonate semialdehyde |
| + | ** malonic semialdehyde |
| | | |
− | == Reactions associated == | + | == Reaction(s) known to consume the compound == |
− | * Reaction: [[ADPA]] | + | * [[RXN-2902]] |
− | ** Source: [[orthology-creinhardtii]]
| + | == Reaction(s) known to produce the compound == |
− | * Reaction: [[APYRASE-RXN]]
| + | == Reaction(s) of unknown directionality == |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[ATPASE-RXN]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[ATPPH]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[CTPH]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[DTNH]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[GDPA]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[GTPA]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[GUANOSINE-DIPHOSPHATASE-RXN]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Reaction: [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-10862]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Reaction: [[RXN-12195]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-12196]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-12197]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-12198]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[RXN-12199]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-12200]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14003]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[RXN-14024]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14187]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14195]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14198]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14199]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14200]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14201]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14205]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14208]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14213]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[RXN-14214]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14215]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14216]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14217]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14218]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14219]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN-14220]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[RXN0-3542]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Reaction: [[RXN0-5073]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[RXN0-5462]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Reaction: [[THYMIDINE-TRIPHOSPHATASE-RXN]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: ec-number
| + | |
− | * Reaction: [[UPH]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Reaction: [[UTPH]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | == Pathways associated == | + | |
− | * [[PWY-7210]]
| + | |
− | * [[PWY-7198]]
| + | |
− | * [[PWY-7177]]
| + | |
− | * [[PWY-7185]]
| + | |
− | * [[PWY-7184]]
| + | |
− | * [[PWY-6545]]
| + | |
| == External links == | | == External links == |
− | {{#set: right end position=6537}} | + | * CAS : 926-61-4 |
− | {{#set: transcription direction=NEGATIVE}} | + | * PUBCHEM: |
− | {{#set: left end position=3684}} | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543142 9543142] |
− | {{#set: centisome position=55.398495 }} | + | * HMDB : HMDB11111 |
− | {{#set: reaction associated=ADPA|APYRASE-RXN|ATPASE-RXN|ATPPH|CTPH|DTNH|GDPA|GTPA|GUANOSINE-DIPHOSPHATASE-RXN|NUCLEOSIDE-DIPHOSPHATASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-10862|RXN-12195|RXN-12196|RXN-12197|RXN-12198|RXN-12199|RXN-12200|RXN-14003|RXN-14024|RXN-14187|RXN-14195|RXN-14198|RXN-14199|RXN-14200|RXN-14201|RXN-14205|RXN-14208|RXN-14213|RXN-14214|RXN-14215|RXN-14216|RXN-14217|RXN-14218|RXN-14219|RXN-14220|RXN0-3542|RXN0-5073|RXN0-5462|THYMIDINE-TRIPHOSPHATASE-RXN|UPH|UTPH}} | + | * LIGAND-CPD: |
− | {{#set: pathway associated=PWY-7210|PWY-7198|PWY-7177|PWY-7185|PWY-7184|PWY-6545}} | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00222 C00222] |
| + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.7822115.html 7822115] |
| + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33190 33190] |
| + | * METABOLIGHTS : MTBLC33190 |
| + | {{#set: smiles=[CH](=O)CC([O-])=O}} |
| + | {{#set: common name=3-oxopropanoate}} |
| + | {{#set: inchi key=InChIKey=OAKURXIZZOAYBC-UHFFFAOYSA-M}} |
| + | {{#set: molecular weight=87.055 }} |
| + | {{#set: common name=malonate semialdehyde|malonic semialdehyde}} |
| + | {{#set: consumed by=RXN-2902}} |