Difference between revisions of "MALONATE-S-ALD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12899 == * right end position: ** 6537 * transcription direction: ** NEGATIVE * left end position: ** 3684 * centisome position: ** 55.3984...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONATE-S-ALD MALONATE-S-ALD] == * smiles: ** [CH](=O)CC([O-])=O * common name: ** 3-oxopropan...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12899 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONATE-S-ALD MALONATE-S-ALD] ==
* right end position:
+
* smiles:
** 6537
+
** [CH](=O)CC([O-])=O
* transcription direction:
+
* common name:
** NEGATIVE
+
** 3-oxopropanoate
* left end position:
+
* inchi key:
** 3684
+
** InChIKey=OAKURXIZZOAYBC-UHFFFAOYSA-M
* centisome position:
+
* molecular weight:
** 55.398495    
+
** 87.055    
 
* Synonym(s):
 
* Synonym(s):
 +
** malonate semialdehyde
 +
** malonic semialdehyde
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[ADPA]]
+
* [[RXN-2902]]
** Source: [[orthology-creinhardtii]]
+
== Reaction(s) known to produce the compound ==
* Reaction: [[APYRASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[ATPASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[ATPPH]]
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[CTPH]]
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[DTNH]]
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[GDPA]]
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[GTPA]]
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[GUANOSINE-DIPHOSPHATASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
** Source: [[orthology-athaliana]]
+
** Source: [[orthology-esiliculosus]]
+
* Reaction: [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-10862]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
** Source: [[orthology-athaliana]]
+
** Source: [[orthology-esiliculosus]]
+
* Reaction: [[RXN-12195]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12196]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12197]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12198]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[RXN-12199]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12200]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14003]]
+
** Source: [[orthology-athaliana]]
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[RXN-14024]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14187]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14195]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14198]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14199]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14200]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14201]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14205]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14208]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14213]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[RXN-14214]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14215]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14216]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14217]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14218]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14219]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-14220]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN0-3542]]
+
** Source: [[orthology-athaliana]]
+
** Source: [[orthology-esiliculosus]]
+
* Reaction: [[RXN0-5073]]
+
** Source: [[orthology-athaliana]]
+
** Source: [[orthology-esiliculosus]]
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[RXN0-5462]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
** Source: [[orthology-athaliana]]
+
** Source: [[orthology-esiliculosus]]
+
* Reaction: [[THYMIDINE-TRIPHOSPHATASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: ec-number
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
* Reaction: [[UPH]]
+
** Source: [[orthology-creinhardtii]]
+
* Reaction: [[UTPH]]
+
** Source: [[orthology-creinhardtii]]
+
== Pathways associated ==
+
* [[PWY-7210]]
+
* [[PWY-7198]]
+
* [[PWY-7177]]
+
* [[PWY-7185]]
+
* [[PWY-7184]]
+
* [[PWY-6545]]
+
 
== External links  ==
 
== External links  ==
{{#set: right end position=6537}}
+
* CAS : 926-61-4
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: left end position=3684}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543142 9543142]
{{#set: centisome position=55.398495   }}
+
* HMDB : HMDB11111
{{#set: reaction associated=ADPA|APYRASE-RXN|ATPASE-RXN|ATPPH|CTPH|DTNH|GDPA|GTPA|GUANOSINE-DIPHOSPHATASE-RXN|NUCLEOSIDE-DIPHOSPHATASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-10862|RXN-12195|RXN-12196|RXN-12197|RXN-12198|RXN-12199|RXN-12200|RXN-14003|RXN-14024|RXN-14187|RXN-14195|RXN-14198|RXN-14199|RXN-14200|RXN-14201|RXN-14205|RXN-14208|RXN-14213|RXN-14214|RXN-14215|RXN-14216|RXN-14217|RXN-14218|RXN-14219|RXN-14220|RXN0-3542|RXN0-5073|RXN0-5462|THYMIDINE-TRIPHOSPHATASE-RXN|UPH|UTPH}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-7177|PWY-7185|PWY-7184|PWY-6545}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00222 C00222]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.7822115.html 7822115]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33190 33190]
 +
* METABOLIGHTS : MTBLC33190
 +
{{#set: smiles=[CH](=O)CC([O-])=O}}
 +
{{#set: common name=3-oxopropanoate}}
 +
{{#set: inchi key=InChIKey=OAKURXIZZOAYBC-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=87.055   }}
 +
{{#set: common name=malonate semialdehyde|malonic semialdehyde}}
 +
{{#set: consumed by=RXN-2902}}

Latest revision as of 20:23, 21 March 2018

Metabolite MALONATE-S-ALD

  • smiles:
    • [CH](=O)CC([O-])=O
  • common name:
    • 3-oxopropanoate
  • inchi key:
    • InChIKey=OAKURXIZZOAYBC-UHFFFAOYSA-M
  • molecular weight:
    • 87.055
  • Synonym(s):
    • malonate semialdehyde
    • malonic semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 926-61-4
  • PUBCHEM:
  • HMDB : HMDB11111
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • METABOLIGHTS : MTBLC33190
"CH](=O)CC([O-])=O" cannot be used as a page name in this wiki.