Difference between revisions of "RIBITOL-2-DEHYDROGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(7'-m...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL-2-DEHYDROGENASE-RXN RIBITOL-2-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE * ec number:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL-2-DEHYDROGENASE-RXN RIBITOL-2-DEHYDROGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.56 EC-1.1.1.56] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[NAD]][c] '''+''' 1 [[RIBITOL]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[D-RIBULOSE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 NAD+[c] '''+''' 1 ribitol[c] '''<=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 D-ribulose[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_15780]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_10870]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5087]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14162]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[RIBITOLUTIL-PWY]], ribitol degradation: [http://metacyc.org/META/NEW-IMAGE?object=RIBITOLUTIL-PWY RIBITOLUTIL-PWY] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20053 20053] |
− | + | * LIGAND-RXN: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01895 R01895] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00335 P00335] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: ec number=EC-1.1.1.56}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_15780|Tiso_gene_10870|Tiso_gene_5087|Tiso_gene_14162}} |
+ | {{#set: in pathway=RIBITOLUTIL-PWY}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 20:23, 21 March 2018
Contents
Reaction RIBITOL-2-DEHYDROGENASE-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 RIBITOL[c] <=> 1 NADH[c] + 1 PROTON[c] + 1 D-RIBULOSE[c]
- With common name(s):
- 1 NAD+[c] + 1 ribitol[c] <=> 1 NADH[c] + 1 H+[c] + 1 D-ribulose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15780
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10870
- Source: orthology-esiliculosus
- Gene: Tiso_gene_5087
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14162
- Source: orthology-esiliculosus
Pathways
- RIBITOLUTIL-PWY, ribitol degradation: RIBITOLUTIL-PWY
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links