Difference between revisions of "Tiso gene 6431"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...")
(Created page with "Category:Gene == Gene Tiso_gene_6431 == * Synonym(s): == Reactions associated == * Reaction: PEROXID-RXN ** Source: orthology-esiliculosus * Reaction: RXN-14240...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
+
== Gene Tiso_gene_6431 ==
−
* smiles:
+
−
** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
−
* common name:
+
−
** (R)-S-lactoylglutathione
+
−
* inchi key:
+
−
** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
+
−
* molecular weight:
+
−
** 378.376   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-D-lactoylglutathione
 
−
** D-lactoylglutathione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[GLYOXII-RXN]]
+
* Reaction: [[PEROXID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-14240]]
−
* [[GLYOXI-RXN]]
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7445]]
 +
* [[PWY-7214]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* CAS : 25138-66-3
+
{{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-8635}}
−
* PUBCHEM:
+
{{#set: pathway associated=PWY-7445|PWY-7214|PWY-5461}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377]
+
−
* HMDB : HMDB01066
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474]
+
−
* BIGG : lgt__S
+
−
{{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
−
{{#set: common name=(R)-S-lactoylglutathione}}
+
−
{{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}}
+
−
{{#set: molecular weight=378.376    }}
+
−
{{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}}
+
−
{{#set: consumed by=GLYOXII-RXN}}
+
−
{{#set: reversible reaction associated=GLYOXI-RXN}}
+

Latest revision as of 20:23, 21 March 2018

Gene Tiso_gene_6431

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6431&oldid=48411"