Difference between revisions of "Tiso gene 4661"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * common name:...") |
(Created page with "Category:Gene == Gene Tiso_gene_4661 == * right end position: ** 14602 * transcription direction: ** NEGATIVE * left end position: ** 11785 * centisome position: ** 80.691...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4661 == |
− | * | + | * right end position: |
− | ** | + | ** 14602 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 11785 |
− | * | + | * centisome position: |
− | ** | + | ** 80.69154 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[UDPNACETYLMURAMATEDEHYDROG-RXN]] |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-6386]] |
+ | * [[PWY-6387]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=14602}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=11785}} | |
− | + | {{#set: centisome position=80.69154 }} | |
− | + | {{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}} | |
− | + | {{#set: pathway associated=PWY-6386|PWY-6387}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:24, 21 March 2018
Gene Tiso_gene_4661
- right end position:
- 14602
- transcription direction:
- NEGATIVE
- left end position:
- 11785
- centisome position:
- 80.69154
- Synonym(s):
Reactions associated
- Reaction: UDPNACETYLMURAMATEDEHYDROG-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation