Difference between revisions of "Tiso gene 18825"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * common na...") |
(Created page with "Category:Gene == Gene Tiso_gene_18825 == * right end position: ** 2100 * transcription direction: ** POSITIVE * left end position: ** 5 * centisome position: ** 0.18050541...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18825 == |
− | * | + | * right end position: |
− | ** | + | ** 2100 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5 |
− | * | + | * centisome position: |
− | ** | + | ** 0.18050541 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-14903]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN0-7008]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PROUT-PWY]] | ||
+ | * [[PWY-6922]] | ||
+ | * [[PWY-5737]] | ||
+ | * [[PWY0-1544]] | ||
+ | * [[CITRULBIO-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2100}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5}} | |
− | + | {{#set: centisome position=0.18050541 }} | |
− | + | {{#set: reaction associated=RXN-14903|RXN0-7008}} | |
− | + | {{#set: pathway associated=PROUT-PWY|PWY-6922|PWY-5737|PWY0-1544|CITRULBIO-PWY}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:24, 21 March 2018
Gene Tiso_gene_18825
- right end position:
- 2100
- transcription direction:
- POSITIVE
- left end position:
- 5
- centisome position:
- 0.18050541
- Synonym(s):
Reactions associated
- Reaction: RXN-14903
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-7008
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation