Difference between revisions of "Tiso gene 18366"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * common name: ** isoguanine...") |
(Created page with "Category:Gene == Gene Tiso_gene_18366 == * right end position: ** 3006 * transcription direction: ** POSITIVE * left end position: ** 518 * centisome position: ** 16.91704...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18366 == |
− | * | + | * right end position: |
− | ** | + | ** 3006 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 518 |
− | * | + | * centisome position: |
− | ** | + | ** 16.917048 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[URITRANS-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3006}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=518}} | |
− | + | {{#set: centisome position=16.917048 }} | |
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN|URITRANS-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:25, 21 March 2018
Gene Tiso_gene_18366
- right end position:
- 3006
- transcription direction:
- POSITIVE
- left end position:
- 518
- centisome position:
- 16.917048
- Synonym(s):
Reactions associated
- Reaction: NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: URITRANS-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation