Difference between revisions of "CPD1F-128"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BCor BCor] == * direction: ** REVERSIBLE * common name: ** butanoyl-CoA:(acceptor) 2,3-oxidoreducta...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * comm...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BCor BCor] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))
 
* common name:
 
* common name:
−
** butanoyl-CoA:(acceptor) 2,3-oxidoreductase
+
** ent-kaurene
 +
* inchi key:
 +
** InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N
 +
* molecular weight:
 +
** 272.473   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-kaur-16-ene
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.14.13.78-RXN]]
−
** 1.0 [[NAD]][c] '''+''' 1.0 [[BUTYRYL-COA]][c] '''<=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] '''+''' 1.0 [[CROTONYL-COA]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 NAD+[c] '''+''' 1.0 butanoyl-CoA[c] '''<=>''' 1.0 H+[c] '''+''' 1.0 NADH[c] '''+''' 1.0 crotonyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10643]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_16113]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* LIPID_MAPS : LMPR0104130002
−
{{#set: common name=butanoyl-CoA:(acceptor) 2,3-oxidoreductase}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_10643|Tiso_gene_16113}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966109 11966109]
−
{{#set: in pathway=}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.chemspider.com/Chemical-Structure.16737395.html 16737395]
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15415 15415]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06090 C06090]
 +
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))}}
 +
{{#set: common name=ent-kaurene}}
 +
{{#set: inchi key=InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N}}
 +
{{#set: molecular weight=272.473    }}
 +
{{#set: common name=ent-kaur-16-ene}}
 +
{{#set: consumed by=1.14.13.78-RXN}}

Latest revision as of 20:25, 21 March 2018

Metabolite CPD1F-128

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))
  • common name:
    • ent-kaurene
  • inchi key:
    • InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N
  • molecular weight:
    • 272.473
  • Synonym(s):
    • ent-kaur-16-ene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-128&oldid=48626"