Difference between revisions of "PWY-6539"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6539 PWY-6539] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3524 TAX-35...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6539 PWY-6539] == |
| − | * | + | * taxonomic range: |
| − | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3524 TAX-3524] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (Z)-phenylmethanethial S-oxide biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-8899]] |
| − | * [ | + | ** 0 associated gene: |
| − | * [ | + | ** 2 reconstruction source(s) associated: |
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11524 RXN-11524] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11525 RXN-11525] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11526 RXN-11526] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3524}} | |
| − | + | {{#set: common name=(Z)-phenylmethanethial S-oxide biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | {{#set: | + | {{#set: completion rate=25.0}} |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:41, 21 March 2018
Pathway PWY-6539
- taxonomic range:
- common name:
- (Z)-phenylmethanethial S-oxide biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- RXN-8899
- 0 associated gene:
- 2 reconstruction source(s) associated:
