Difference between revisions of "RXN-16997"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLOSE XYLOSE] == * smiles: ** C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=SRBFZHDQGSBBOR-L...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16997 RXN-16997] == * direction: ** LEFT-TO-RIGHT * common name: ** cytoplasmic ** pgm_pmm * Sy...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLOSE XYLOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16997 RXN-16997] ==
* smiles:
+
* direction:
** C1(OC(O)C(O)C(O)C(O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SRBFZHDQGSBBOR-LECHCGJUSA-N
+
 
* common name:
 
* common name:
** α-D-xylopyranose
+
** cytoplasmic
* molecular weight:
+
** pgm_pmm
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
** α-D-xylose
 
** xylose
 
** D-xylose
 
** wood sugar
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[1.1.3.41-RXN]]
+
** 1 [[GLC-1-P]][c] '''+''' 1 [[Phosphorylated-phosphoglucomutase]][c] '''=>''' 1 [[ALPHA-GLUCOSE-16-BISPHOSPHATE]][c] '''+''' 1 [[Phosphoglucomutase]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 α-D-glucopyranose 1-phosphate[c] '''+''' 1 a phosphorylated phosphoglucomutase[c] '''=>''' 1 α-glucose 1,6-bisphosphate[c] '''+''' 1 a phosphoglucomutase[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4816]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13477]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 58-86-6
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC28518
+
{{#set: common name=cytoplasmic}}
* DRUGBANK : DB03389
+
{{#set: common name=pgm_pmm}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_4816|Tiso_gene_13477}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6027 6027]
+
{{#set: in pathway=}}
* HMDB : HMDB00098
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C01394 C01394]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5805.html 5805]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28518 28518]
+
* BIGG : xyl__D
+
{{#set: smiles=C1(OC(O)C(O)C(O)C(O)1)}}
+
{{#set: inchi key=InChIKey=SRBFZHDQGSBBOR-LECHCGJUSA-N}}
+
{{#set: common name=α-D-xylopyranose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: common name=α-D-xylose|xylose|D-xylose|wood sugar}}
+
{{#set: produced by=1.1.3.41-RXN}}
+

Latest revision as of 19:42, 21 March 2018

Reaction RXN-16997

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cytoplasmic
    • pgm_pmm
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links