Difference between revisions of "PWY-7072"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7072 PWY-7072] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7072 PWY-7072] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** hopanoid biosynthesis (bacteria) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''1''' reactions found over '''14''' reactions in the full pathway |
− | * [[RXN- | + | * [[5.4.99.17-RXN]] |
− | == | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_12198]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12263 RXN-12263] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12337 RXN-12337] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13528 RXN-13528] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13529 RXN-13529] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13530 RXN-13530] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13531 RXN-13531] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13532 RXN-13532] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13533 RXN-13533] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13534 RXN-13534] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13535 RXN-13535] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17128 RXN-17128] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17129 RXN-17129] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4961 RXN-4961] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=hopanoid biosynthesis (bacteria)}} | |
− | + | {{#set: reaction found=1}} | |
− | {{#set: | + | {{#set: total reaction=14}} |
− | + | {{#set: completion rate=7.0}} | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:42, 21 March 2018
Pathway PWY-7072
- taxonomic range:
- common name:
- hopanoid biosynthesis (bacteria)
- Synonym(s):
Reaction(s) found
1 reactions found over 14 reactions in the full pathway
- 5.4.99.17-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- RXN-12263
- RXN-12337
- RXN-13528
- RXN-13529
- RXN-13530
- RXN-13531
- RXN-13532
- RXN-13533
- RXN-13534
- RXN-13535
- RXN-17128
- RXN-17129
- RXN-4961