Difference between revisions of "PWY-7072"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7072 PWY-7072] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7072 PWY-7072] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** N-acetyl-serotonin sulfate
+
** hopanoid biosynthesis (bacteria)
−
* molecular weight:
+
−
** 297.305   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetyl-5-hydroxytryptamine sulfate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''14''' reactions in the full pathway
−
* [[RXN-11059]]
+
* [[5.4.99.17-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_12198]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12263 RXN-12263]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12337 RXN-12337]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13528 RXN-13528]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13529 RXN-13529]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13530 RXN-13530]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13531 RXN-13531]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13532 RXN-13532]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13533 RXN-13533]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13534 RXN-13534]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13535 RXN-13535]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17128 RXN-17128]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17129 RXN-17129]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-4961 RXN-4961]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514958 102514958]
+
{{#set: common name=hopanoid biosynthesis (bacteria)}}
−
* HMDB : HMDB60834
+
{{#set: reaction found=1}}
−
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
+
{{#set: total reaction=14}}
−
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
+
{{#set: completion rate=7.0}}
−
{{#set: common name=N-acetyl-serotonin sulfate}}
+
−
{{#set: molecular weight=297.305    }}
+
−
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
+
−
{{#set: produced by=RXN-11059}}
+

Latest revision as of 20:42, 21 March 2018

Pathway PWY-7072

  • taxonomic range:
  • common name:
    • hopanoid biosynthesis (bacteria)
  • Synonym(s):

Reaction(s) found

1 reactions found over 14 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7072&oldid=43369"