Difference between revisions of "Tiso gene 12272"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12272 == * right end position: ** 1346 * transcription direction: ** NEGATIVE * left end position: ** 26 * centisome position: ** 0.3619657...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] ==
+
== Gene Tiso_gene_12272 ==
−
* smiles:
+
* right end position:
−
** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** 1346
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** methylacrylyl-CoA
+
** 26
−
* molecular weight:
+
* centisome position:
−
** 831.577    
+
** 0.36196575    
 
* Synonym(s):
 
* Synonym(s):
−
** methacrylyl-CoA
 
−
** 2-methylprop-2-enoyl-CoA
 
−
** methacrylyl-coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[F16ALDOLASE-RXN]]
−
* [[MEPROPCOA-FAD-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[MCDH]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
−
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-8631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[SEDOBISALDOL-RXN]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY66-399]]
 +
* [[PWY66-373]]
 +
* [[SUCSYN-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-7385]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[CALVIN-PWY]]
 +
* [[PWY0-1517]]
 +
* [[PWY-1861]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[P185-PWY]]
 +
* [[GLUCONEO-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6008-91-9
+
{{#set: right end position=1346}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325]
+
{{#set: left end position=26}}
−
* CHEBI:
+
{{#set: centisome position=0.36196575   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500]
+
{{#set: reaction associated=F16ALDOLASE-RXN|RXN-8631|SEDOBISALDOL-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY66-399|PWY66-373|SUCSYN-PWY|GLYCOLYSIS|PWY-7385|ANAGLYCOLYSIS-PWY|CALVIN-PWY|PWY0-1517|PWY-1861|PWY-6142|PWY-5484|P185-PWY|GLUCONEO-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460]
+
−
* HMDB : HMDB01011
+
−
{{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
−
{{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}}
+
−
{{#set: common name=methylacrylyl-CoA}}
+
−
{{#set: molecular weight=831.577   }}
+
−
{{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}}
+
−
{{#set: produced by=MEPROPCOA-FAD-RXN|MCDH}}
+
−
{{#set: consumed or produced by=METHYLACYLYLCOA-HYDROXY-RXN}}
+

Latest revision as of 19:42, 21 March 2018

Gene Tiso_gene_12272

  • right end position:
    • 1346
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 26
  • centisome position:
    • 0.36196575
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12272&oldid=43379"