Difference between revisions of "CPD-15699"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] == * common name: ** an apo-[VibB aryl-carrier protein] * Synonym(s): == Reaction(s...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-L-arabin...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] ==
 +
* smiles:
 +
** [CH](=O)C(O)C(O)C(O)CO
 
* common name:
 
* common name:
** an apo-[VibB aryl-carrier protein]
+
** aldehydo-L-arabinose
 +
* inchi key:
 +
** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
  
Line 8: Line 14:
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-10994]]
+
* [[RXN-14102]]
 +
* [[RXN-14808]]
 
== External links  ==
 
== External links  ==
{{#set: common name=an apo-[VibB aryl-carrier protein]}}
+
* PUBCHEM:
{{#set: consumed or produced by=RXN-10994}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476]
 +
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
 +
{{#set: common name=aldehydo-L-arabinose}}
 +
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}}
 +
{{#set: molecular weight=150.131    }}
 +
{{#set: reversible reaction associated=RXN-14102|RXN-14808}}

Latest revision as of 19:08, 21 March 2018

Metabolite CPD-15699

  • smiles:
    • [CH](=O)C(O)C(O)C(O)CO
  • common name:
    • aldehydo-L-arabinose
  • inchi key:
    • InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
  • molecular weight:
    • 150.131
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.