Difference between revisions of "N-ACETYL-BETA-GLUCOSAMINYLAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D17-29-3-hydroxyC48-2-ACPs cis-cis-D17-29-3-hydroxyC48-2-ACPs] == * common name: ** a c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] == * smiles: ** CC(=O)NC1(C(N)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] == |
| + | * smiles: | ||
| + | ** CC(=O)NC1(C(N)OC(CO)C(O)C(O)1) | ||
* common name: | * common name: | ||
| − | ** | + | ** N-acetyl-β-glucosaminylamine |
| + | * inchi key: | ||
| + | ** InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N | ||
| + | * molecular weight: | ||
| + | ** 220.225 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[3.5.1.52-RXN]] | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439454 439454] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.388560.html 388560] | ||
| + | * HMDB : HMDB01104 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15947 15947] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01239 C01239] | ||
| + | {{#set: smiles=CC(=O)NC1(C(N)OC(CO)C(O)C(O)1)}} | ||
| + | {{#set: common name=N-acetyl-β-glucosaminylamine}} | ||
| + | {{#set: inchi key=InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N}} | ||
| + | {{#set: molecular weight=220.225 }} | ||
| + | {{#set: reversible reaction associated=3.5.1.52-RXN}} | ||
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE
- smiles:
- CC(=O)NC1(C(N)OC(CO)C(O)C(O)1)
- common name:
- N-acetyl-β-glucosaminylamine
- inchi key:
- InChIKey=MCGXOCXFFNKASF-FMDGEEDCSA-N
- molecular weight:
- 220.225
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
