Difference between revisions of "13-HYDROXY-MAGNESIUM-PROTOPORP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] == * smiles: ** C=CC2(C(C)=C4(C=...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8)))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 613.974 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-5283]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-5282]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658233 90658233] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60489 60489] |
| − | {{#set: smiles=C( | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11829 C11829] | |
| − | {{#set: common name= | + | * HMDB : HMDB02379 |
| − | {{#set: molecular weight= | + | {{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))}} |
| − | {{#set: common name= | + | {{#set: common name=131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=613.974 }} |
| + | {{#set: common name=131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester}} | ||
| + | {{#set: consumed by=RXN-5283}} | ||
| + | {{#set: produced by=RXN-5282}} | ||
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite 13-HYDROXY-MAGNESIUM-PROTOPORP
- smiles:
- C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))
- common name:
- 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester
- molecular weight:
- 613.974
- Synonym(s):
- 131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.
