Difference between revisions of "Tiso gene 1666"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_1666 == * Synonym(s): == Reactions associated == * Reaction: GSHTRAN-RXN ** Source: orthology-athaliana == Pathways associated ==...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_1666 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[GSHTRAN-RXN]] |
| − | == | + | ** Source: [[orthology-athaliana]] |
| − | * [[ | + | == Pathways associated == |
| − | + | * [[PWY-6842]] | |
| + | * [[PWY-4061]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=GSHTRAN-RXN}} | |
| − | + | {{#set: pathway associated=PWY-6842|PWY-4061}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:43, 21 March 2018
Gene Tiso_gene_1666
- Synonym(s):
Reactions associated
- Reaction: GSHTRAN-RXN
- Source: orthology-athaliana
