Difference between revisions of "CANAVANINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9500 RXN-9500] == * direction: ** LEFT-TO-RIGHT * common name: ** o-methyltransferase_i * ec nu...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * common name: ** L-cana...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9500 RXN-9500] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(CC([N+])C(=O)[O-])ONC(=[N+])N
 
* common name:
 
* common name:
−
** o-methyltransferase_i
+
** L-canavanine
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.1.1.109 EC-2.1.1.109]
+
** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
 +
* molecular weight:
 +
** 177.183   
 
* Synonym(s):
 
* Synonym(s):
 +
** canavanine
 +
** 2-amino-4-(guanidinooxy)butyrate
 +
** 2-amino-4-(guanidinooxy)butyric acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-4586]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-4587]][c]
+
* [[RXN-22]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 dihydrodemethylsterigmatocystin[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 dihydrosterigmatocystin[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_20416]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5960]], aflatoxins B2 and G2 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5960 PWY-5960]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 543-38-4
−
{{#set: common name=o-methyltransferase_i}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.1.1.109}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185]
−
{{#set: gene associated=Tiso_gene_20416}}
+
* HMDB : HMDB02706
−
{{#set: in pathway=PWY-5960}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902]
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308]
 +
{{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}}
 +
{{#set: common name=L-canavanine}}
 +
{{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}}
 +
{{#set: molecular weight=177.183    }}
 +
{{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}}
 +
{{#set: produced by=RXN-22}}

Latest revision as of 19:08, 21 March 2018

Metabolite CANAVANINE

  • smiles:
    • C(CC([N+])C(=O)[O-])ONC(=[N+])N
  • common name:
    • L-canavanine
  • inchi key:
    • InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
  • molecular weight:
    • 177.183
  • Synonym(s):
    • canavanine
    • 2-amino-4-(guanidinooxy)butyrate
    • 2-amino-4-(guanidinooxy)butyric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC([N+])C(=O)[O-])ONC(=[N+])N" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CANAVANINE&oldid=39681"