Difference between revisions of "PWY-6154"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6154 PWY-6154] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-135623 TAX-...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6154 PWY-6154] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-135623 TAX-135623] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** autoinducer AI-2 biosynthesis II (Vibrio) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''6''' reactions in the full pathway |
− | == Reaction(s) | + | * [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]] |
− | == | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_14191]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-7605]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYLHOMOCYSTEINASE-RXN RIBOSYLHOMOCYSTEINASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10016 RXN-10016] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10018 RXN-10018] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10019 RXN-10019] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-135623}} | |
− | + | {{#set: common name=autoinducer AI-2 biosynthesis II (Vibrio)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:44, 21 March 2018
Pathway PWY-6154
- taxonomic range:
- common name:
- autoinducer AI-2 biosynthesis II (Vibrio)
- Synonym(s):
Reaction(s) found
2 reactions found over 6 reactions in the full pathway
- ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-7605
- 0 associated gene:
- 1 reconstruction source(s) associated: