Difference between revisions of "Tiso gene 11980"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * smiles: ** CC(CC([N+])C([O-])=O)C * inchi key: ** InChIKey=ROHFNLRQFUQHCH-YFKPBYR...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11980 == * Synonym(s): == Reactions associated == * Reaction: RXN-8028 ** Source: orthology-athaliana ** Source: orthology-esili...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] ==
+
== Gene Tiso_gene_11980 ==
−
* smiles:
+
−
** CC(CC([N+])C([O-])=O)C
+
−
* inchi key:
+
−
** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N
+
−
* common name:
+
−
** L-leucine
+
−
* molecular weight:
+
−
** 131.174   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2S)-α-2-amino-4-methylvaleric acid
 
−
** L
 
−
** leu
 
−
** leucine
 
−
** 2-amino-4-methylvaleric acid
 
−
** (2S)-α-leucine
 
−
** L-leu
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[LEUCINE--TRNA-LIGASE-RXN]]
+
* Reaction: [[RXN-8028]]
−
* [[RME144]]
+
** Source: [[orthology-athaliana]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-creinhardtii]]
−
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
+
* Reaction: [[RXN-8038]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-8040]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN1F-147]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN1F-148]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN1F-150]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN1F-151]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-5947]]
 +
* [[PWY-5946]]
 +
* [[PWY-7591]]
 +
* [[PWY-5943]]
 +
* [[PWY-5175]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: reaction associated=RXN-8028|RXN-8038|RXN-8040|RXN1F-147|RXN1F-148|RXN1F-150|RXN1F-151}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46709 46709]
+
{{#set: pathway associated=PWY-5947|PWY-5946|PWY-7591|PWY-5943|PWY-5175}}
−
* CAS : 61-90-5
+
−
* METABOLIGHTS : MTBLC57427
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7045798 7045798]
+
−
* HMDB : HMDB00687
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00123 C00123]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427]
+
−
* BIGG : leu__L
+
−
{{#set: smiles=CC(CC([N+])C([O-])=O)C}}
+
−
{{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}}
+
−
{{#set: common name=L-leucine}}
+
−
{{#set: molecular weight=131.174    }}
+
−
{{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}}
+
−
{{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|RME144}}
+
−
{{#set: consumed or produced by=BRANCHED-CHAINAMINOTRANSFERLEU-RXN}}
+

Latest revision as of 19:44, 21 March 2018

Gene Tiso_gene_11980

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11980&oldid=43542"