Difference between revisions of "CPDQT-27"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6147 PWY-6147] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == * smiles: ** CSCCCCC(=O)C([O-])=O * common name: ** 6-(methylthio)-2-oxoh...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == |
| − | * | + | * smiles: |
| − | ** | + | ** CSCCCCC(=O)C([O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 6- | + | ** 6-(methylthio)-2-oxohexanoate |
| + | * inchi key: | ||
| + | ** InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 175.222 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 6-(methylthio)-2-oxohexanoic acid | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-18209]] | |
| − | + | * [[RXNQT-4165]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237195 44237195] |
| − | {{#set: | + | * KNAPSACK : C00007648 |
| − | {{#set: | + | {{#set: smiles=CSCCCCC(=O)C([O-])=O}} |
| − | {{#set: | + | {{#set: common name=6-(methylthio)-2-oxohexanoate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=175.222 }} |
| − | {{#set: | + | {{#set: common name=6-(methylthio)-2-oxohexanoic acid}} |
| + | {{#set: produced by=RXN-18209|RXNQT-4165}} | ||
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite CPDQT-27
- smiles:
- CSCCCCC(=O)C([O-])=O
- common name:
- 6-(methylthio)-2-oxohexanoate
- inchi key:
- InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
- molecular weight:
- 175.222
- Synonym(s):
- 6-(methylthio)-2-oxohexanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007648
"CSCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.
