Difference between revisions of "CPD-13912"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5 HACD5] == * direction: ** REVERSIBLE * common name: ** (S)-3-hydroxydodecanoyl-CoA:NAD oxidor...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * common name: ** 2-c...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5 HACD5] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
 
* common name:
 
* common name:
−
** (S)-3-hydroxydodecanoyl-CoA:NAD oxidoreductase
+
** 2-carboxy-L-threo-pentonate
 +
* inchi key:
 +
** InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 208.124   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-carboxy-L-xylonate
 +
** 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[CPD0-2107]][x] '''+''' 1.0 [[NAD]][x] '''<=>''' 1.0 [[PROTON]][x] '''+''' 1.0 [[NADH]][x] '''+''' 1.0 [[CPD0-2105]][x]
+
* [[RXN-12871]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 (S)-3-hydroxydodecanoyl-CoA[x] '''+''' 1.0 NAD+[x] '''<=>''' 1.0 H+[x] '''+''' 1.0 NADH[x] '''+''' 1.0 3-oxododecanoyl-CoA[x]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5857]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=(S)-3-hydroxydodecanoyl-CoA:NAD oxidoreductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657336 90657336]
−
{{#set: gene associated=Tiso_gene_5857}}
+
{{#set: smiles=C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O}}
−
{{#set: in pathway=}}
+
{{#set: common name=2-carboxy-L-threo-pentonate}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=208.124    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=2-carboxy-L-xylonate|2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate}}
 +
{{#set: produced by=RXN-12871}}

Latest revision as of 19:44, 21 March 2018

Metabolite CPD-13912

  • smiles:
    • C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
  • common name:
    • 2-carboxy-L-threo-pentonate
  • inchi key:
    • InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
  • molecular weight:
    • 208.124
  • Synonym(s):
    • 2-carboxy-L-xylonate
    • 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13912&oldid=43571"