Difference between revisions of "CPD-11756"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7167 == * left end position: ** 1430 * transcription direction: ** POSITIVE * right end position: ** 5898 * centisome position: ** 12.50765...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11756 CPD-11756] == * smiles: ** C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11756 CPD-11756] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl) |
| − | * | + | * common name: |
| − | ** | + | ** 4'-O-demethylrebeccamycin |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 556.358 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10847]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19700 C19700] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=595389 595389] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45259192 45259192] |
| + | {{#set: smiles=C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl)}} | ||
| + | {{#set: common name=4'-O-demethylrebeccamycin}} | ||
| + | {{#set: inchi key=InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N}} | ||
| + | {{#set: molecular weight=556.358 }} | ||
| + | {{#set: consumed by=RXN-10847}} | ||
Latest revision as of 19:45, 21 March 2018
Contents
Metabolite CPD-11756
- smiles:
- C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl)
- common name:
- 4'-O-demethylrebeccamycin
- inchi key:
- InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N
- molecular weight:
- 556.358
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
