Difference between revisions of "Tiso gene 15788"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
(Created page with "Category:Gene == Gene Tiso_gene_15788 == * Synonym(s): == Reactions associated == * Reaction: 3.1.3.16-RXN ** Source: orthology-esiliculosus == Pathways associate...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] ==
+
== Gene Tiso_gene_15788 ==
* smiles:
+
** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J
+
* common name:
+
** icosatrienoyl-2-enoyl CoA
+
* molecular weight:
+
** 1049.959   
+
 
* Synonym(s):
 
* Synonym(s):
** 18:3Δ9,12,15
 
** (9Z,12Z,15Z)-octadecatrienoyl-CoA
 
** eicosatrienoyl-2-enoyl CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12997]]
+
* Reaction: [[3.1.3.16-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
* [[RXN-13001]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3.1.3.16-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551551 72551551]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76456 76456]
+
{{#set: smiles=CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J}}
+
{{#set: common name=icosatrienoyl-2-enoyl CoA}}
+
{{#set: molecular weight=1049.959    }}
+
{{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA|eicosatrienoyl-2-enoyl CoA}}
+
{{#set: consumed by=RXN-12997}}
+
{{#set: produced by=RXN-13001}}
+

Latest revision as of 20:46, 21 March 2018

Gene Tiso_gene_15788

  • Synonym(s):

Reactions associated

Pathways associated

External links