Difference between revisions of "ARGSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGSYN-PWY ARGSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TA...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGSYN-PWY ARGSYN-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
| − | ** | + | ** L-arginine biosynthesis I (via L-ornithine) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''5''' reactions found over '''6''' reactions in the full pathway | |
| − | + | * [[ARGSUCCINLYA-RXN]] | |
| − | * [[RXN- | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_2485]] | ||
| + | ** 7 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | * [[ARGSUCCINSYN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_12592]] | ||
| + | ** 7 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | * [[CARBPSYN-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Tiso_gene_4976]] | ||
| + | *** [[Tiso_gene_4975]] | ||
| + | *** [[Tiso_gene_4685]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[GLUTORN-PWY]] | ||
| + | ** 0 associated gene: | ||
| + | * [[ORNCARBAMTRANSFER-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_18444]] | ||
| + | ** 7 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ARGSYN-PWY ARGSYN-PWY] |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | {{#set: | + | {{#set: common name=L-arginine biosynthesis I (via L-ornithine)}} |
| − | {{#set: | + | {{#set: reaction found=5}} |
| − | {{#set: common name= | + | {{#set: total reaction=6}} |
| − | {{#set: | + | {{#set: completion rate=83.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:04, 21 March 2018
Pathway ARGSYN-PWY
- taxonomic range:
- common name:
- L-arginine biosynthesis I (via L-ornithine)
- Synonym(s):
Reaction(s) found
5 reactions found over 6 reactions in the full pathway
- ARGSUCCINLYA-RXN
- 1 associated gene(s):
- 7 reconstruction source(s) associated:
- ARGSUCCINSYN-RXN
- 1 associated gene(s):
- 7 reconstruction source(s) associated:
- CARBPSYN-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- GLUTORN-PWY
- 0 associated gene:
- ORNCARBAMTRANSFER-RXN
- 1 associated gene(s):
- 7 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
