Difference between revisions of "RXN-11373"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * smiles: ** C1(C=C([O-])C=CC=1[N+](=O)[O-]) * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11373 RXN-11373] == * direction: ** LEFT-TO-RIGHT * common name: ** diphthamide synthase ** dip...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11373 RXN-11373] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** diphthamide synthase |
− | + | ** diphthine_synthase | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [ | + | ** 1 [[3-carboxy-3-dimethylammonio-propyl-L-his]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[DIPHTINE]][c] |
− | + | * With common name(s): | |
− | * [[ | + | ** 1 a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2][c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 a diphthine-[translation elongation factor 2][c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Tiso_gene_15743]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08469 R08469] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=diphthamide synthase}} | |
− | * LIGAND- | + | {{#set: common name=diphthine_synthase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Tiso_gene_15743}} |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:46, 21 March 2018
Contents
Reaction RXN-11373
- direction:
- LEFT-TO-RIGHT
- common name:
- diphthamide synthase
- diphthine_synthase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-carboxy-3-dimethylammonio-propyl-L-his[c] + 1 S-ADENOSYLMETHIONINE[c] => 1 PROTON[c] + 1 ADENOSYL-HOMO-CYS[c] + 1 DIPHTINE[c]
- With common name(s):
- 1 a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2][c] + 1 S-adenosyl-L-methionine[c] => 1 H+[c] + 1 S-adenosyl-L-homocysteine[c] + 1 a diphthine-[translation elongation factor 2][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15743
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: