Difference between revisions of "Palmitoyl-proteins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] == * smiles: ** C1(=CC(C(C=C1)O)O) * inchi key: ** InChIKey=YDRSQRPHLBEPTP-PHD...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Palmitoyl-proteins Palmitoyl-proteins] == * common name: ** a palmitoylated protein * Synonym(s...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Palmitoyl-proteins Palmitoyl-proteins] ==
* smiles:
+
** C1(=CC(C(C=C1)O)O)
+
* inchi key:
+
** InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N
+
 
* common name:
 
* common name:
** (1R,2R)-cyclohexa-3,5-diene-1,2-diol
+
** a palmitoylated protein
* molecular weight:
+
** 112.128   
+
 
* Synonym(s):
 
* Synonym(s):
** trans-1,2-dihydrobenzene-1,2-diol
+
** a palmitoyl-[protein]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.2.22-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[1.3.1.20-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a palmitoylated protein}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=149186 149186]
+
{{#set: common name=a palmitoyl-[protein]}}
* CHEMSPIDER:
+
{{#set: consumed by=3.1.2.22-RXN}}
** [http://www.chemspider.com/Chemical-Structure.131491.html 131491]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10702 10702]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04221 C04221]
+
* HMDB : HMDB01164
+
{{#set: smiles=C1(=CC(C(C=C1)O)O)}}
+
{{#set: inchi key=InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N}}
+
{{#set: common name=(1R,2R)-cyclohexa-3,5-diene-1,2-diol}}
+
{{#set: molecular weight=112.128    }}
+
{{#set: common name=trans-1,2-dihydrobenzene-1,2-diol}}
+
{{#set: consumed or produced by=1.3.1.20-RXN}}
+

Latest revision as of 19:46, 21 March 2018

Metabolite Palmitoyl-proteins

  • common name:
    • a palmitoylated protein
  • Synonym(s):
    • a palmitoyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a palmitoyl-[protein" cannot be used as a page name in this wiki.