Difference between revisions of "PWY66-4"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-332...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] ==
* smiles:
+
* taxonomic range:
** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)CO))CO)))O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N
+
 
* common name:
 
* common name:
** maltotriose
+
** cholesterol biosynthesis III (via desmosterol)
* molecular weight:
+
** 504.441   
+
 
* Synonym(s):
 
* Synonym(s):
** amylotriose
 
** α-D-glucopyranosyl-(1→4)-α-D-glucopyranosyl-(1→4)-D-glucose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN0-5183]]
+
'''7''' reactions found over '''22''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN66-27]]
* [[RXN0-5182]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_8982]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-303]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-304]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-305]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-306]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10982]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-313]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_897]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-318]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_897]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11887 RXN-11887]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-28 RXN66-28]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-310 RXN66-310]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-311 RXN66-311]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-312 RXN66-312]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-314 RXN66-314]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-315 RXN66-315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-316 RXN66-316]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-317 RXN66-317]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-319 RXN66-319]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-320 RXN66-320]
 
== External links  ==
 
== External links  ==
* CAS : 1109-28-0
+
{{#set: taxonomic range=TAX-33208}}
* PUBCHEM:
+
{{#set: common name=cholesterol biosynthesis III (via desmosterol)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439586 439586]
+
{{#set: reaction found=7}}
* HMDB : HMDB01262
+
{{#set: total reaction=22}}
* LIGAND-CPD:
+
{{#set: completion rate=32.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C01835 C01835]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.388669.html 388669]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61993 61993]
+
* BIGG : malttr
+
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)CO))CO)))O}}
+
{{#set: inchi key=InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N}}
+
{{#set: common name=maltotriose}}
+
{{#set: molecular weight=504.441    }}
+
{{#set: common name=amylotriose|α-D-glucopyranosyl-(1→4)-α-D-glucopyranosyl-(1→4)-D-glucose}}
+
{{#set: consumed by=RXN0-5183}}
+
{{#set: produced by=RXN0-5182}}
+

Latest revision as of 19:47, 21 March 2018

Pathway PWY66-4

  • taxonomic range:
  • common name:
    • cholesterol biosynthesis III (via desmosterol)
  • Synonym(s):

Reaction(s) found

7 reactions found over 22 reactions in the full pathway

Reaction(s) not found

External links