Difference between revisions of "CPD-11674"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-Met Protein-With-N-Terminal-Met] == * common name: ** a peptide with an...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * common name:...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == |
+ | * smiles: | ||
+ | ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) | ||
* common name: | * common name: | ||
− | ** | + | ** 5-hydroxytryptophol sulfate |
+ | * inchi key: | ||
+ | ** InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 256.253 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-hydroxytryptophol sulphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10782]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237265 44237265] |
+ | {{#set: smiles=C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))}} | ||
+ | {{#set: common name=5-hydroxytryptophol sulfate}} | ||
+ | {{#set: inchi key=InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=256.253 }} | ||
+ | {{#set: common name=5-hydroxytryptophol sulphate}} | ||
+ | {{#set: produced by=RXN-10782}} |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-11674
- smiles:
- C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))
- common name:
- 5-hydroxytryptophol sulfate
- inchi key:
- InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M
- molecular weight:
- 256.253
- Synonym(s):
- 5-hydroxytryptophol sulphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))" cannot be used as a page name in this wiki.