Difference between revisions of "CPD-289"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] == * smiles: ** CC(=CCCC(=CCOC(C)=O)C)C * inchi key: ** InChIKey=HIGQPQRQIQD...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] == * smiles: ** C1(=CC(C(C=C1)O)O) * common name: ** (1R,2R)-cyclohexa-3,5-die...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(=CC(C(C=C1)O)O) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (1R,2R)-cyclohexa-3,5-diene-1,2-diol |
| + | * inchi key: | ||
| + | ** InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 112.128 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** trans-1,2-dihydrobenzene-1,2-diol |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[1.3.1.20-RXN]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=149186 149186] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.131491.html 131491] |
| + | * HMDB : HMDB01164 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10702 10702] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04221 C04221] |
| − | + | {{#set: smiles=C1(=CC(C(C=C1)O)O)}} | |
| − | {{#set: smiles= | + | {{#set: common name=(1R,2R)-cyclohexa-3,5-diene-1,2-diol}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=112.128 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=trans-1,2-dihydrobenzene-1,2-diol}} |
| − | {{#set: common name= | + | {{#set: reversible reaction associated=1.3.1.20-RXN}} |
| − | {{#set: | + | |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-289
- smiles:
- C1(=CC(C(C=C1)O)O)
- common name:
- (1R,2R)-cyclohexa-3,5-diene-1,2-diol
- inchi key:
- InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N
- molecular weight:
- 112.128
- Synonym(s):
- trans-1,2-dihydrobenzene-1,2-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
