Difference between revisions of "P42-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] == * smiles: ** CC(=O)NC1(C(CC(C([O-])=O)(O)O[...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-22...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-224756]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183939 TAX-183939]
−
** InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183925 TAX-183925]
 
* common name:
 
* common name:
−
** N-acetyl-β-neuraminate 9-phosphate
+
** incomplete reductive TCA cycle
−
* molecular weight:
+
−
** 386.229   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetyl-β-neuraminate-9-P
+
** citric acid cycle variant
−
** N-acetyl-β-neuraminic acid 9-phosphate
+
** tricarboxylic acid cycle variant
 +
** TCA cycle variation I
 +
** incomplete reductive tricarboxylic acid cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''7''' reactions in the full pathway
−
* [[RXN-9988]]
+
* [[FUMHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_3691]]
 +
*** [[Tiso_gene_6720]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_2323]]
 +
*** [[Tiso_gene_1990]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_15144]]
 +
*** [[Tiso_gene_15145]]
 +
*** [[Tiso_gene_2812]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15846]]
 +
*** [[Tiso_gene_11866]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PYRUFLAVREDUCT-RXN PYRUFLAVREDUCT-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-224756}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06241 C06241]
+
{{#set: taxonomic range=TAX-183939}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-183925}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27438 27438]
+
{{#set: common name=incomplete reductive TCA cycle}}
−
* METABOLIGHTS : MTBLC27438
+
{{#set: common name=citric acid cycle variant|tricarboxylic acid cycle variant|TCA cycle variation I|incomplete reductive tricarboxylic acid cycle}}
−
* PUBCHEM:
+
{{#set: reaction found=4}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658964 90658964]
+
{{#set: total reaction=7}}
−
* HMDB : HMDB04381
+
{{#set: completion rate=57.0}}
−
{{#set: smiles=CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)}}
+
−
{{#set: inchi key=InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K}}
+
−
{{#set: common name=N-acetyl-β-neuraminate 9-phosphate}}
+
−
{{#set: molecular weight=386.229    }}
+
−
{{#set: common name=N-acetyl-β-neuraminate-9-P|N-acetyl-β-neuraminic acid 9-phosphate}}
+
−
{{#set: produced by=RXN-9988}}
+

Latest revision as of 19:47, 21 March 2018

Pathway P42-PWY

  • taxonomic range:
  • common name:
    • incomplete reductive TCA cycle
  • Synonym(s):
    • citric acid cycle variant
    • tricarboxylic acid cycle variant
    • TCA cycle variation I
    • incomplete reductive tricarboxylic acid cycle

Reaction(s) found

4 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=P42-PWY&oldid=43772"